CAS 2055842-01-6 appears in our catalog under these names: 2-Naphthalen-1-yl-piperazine dihydrochloride, 95%, 2-NAPHTHALEN-1-YL-PIPERAZINE 2HCL, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-naphthalen-1-ylpiperazine;dihydrochloride (CAS 2055842-01-6) is a chemical compound with the molecular formula C14H18Cl2N2 and a molecular weight of 285.2 g/mol. IUPAC name: 2-naphthalen-1-ylpiperazine;dihydrochloride. InChIKey: WBPLVBJNHVSZPE-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2 |
|---|---|
| Molecular weight | 285.2 g/mol |
| IUPAC name | 2-naphthalen-1-ylpiperazine;dihydrochloride |
| InChIKey | WBPLVBJNHVSZPE-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=CC3=CC=CC=C32.Cl.Cl |
Computed by PubChem (NCBI)