CAS 1269052-79-0 is the registry number for 6-Methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid;hydrochloride (CAS 1269052-79-0) is a chemical compound with the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. IUPAC name: 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid;hydrochloride. InChIKey: WURASFZEWMWKID-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid;hydrochloride |
| InChIKey | WURASFZEWMWKID-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CSC2=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)