Products 19477-32-8
CAS 19477-32-8 is the registry number for Hydrochlorothiazide Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 19477-32-8) is a chemical compound with the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: BGPQXCKFEAZNNZ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | BGPQXCKFEAZNNZ-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C=CC(=C2)Cl)S(=O)(=O)N1 |
Computed by PubChem (NCBI)