Products 199938-17-5
CAS 199938-17-5 appears in our catalog under these names: N'-(2-Chloroacetyl)thiophene-2-carbohydrazide, 95%, N'-(2-Chloroacetyl)thiophene-2-carbohydrazide 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N'-(2-chloroacetyl)thiophene-2-carbohydrazide (CAS 199938-17-5) is a chemical compound with the molecular formula C7H7ClN2O2S and a molecular weight of 218.66 g/mol. IUPAC name: N'-(2-chloroacetyl)thiophene-2-carbohydrazide. InChIKey: XLPQJOHNJBVAQF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | N'-(2-chloroacetyl)thiophene-2-carbohydrazide |
| InChIKey | XLPQJOHNJBVAQF-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NNC(=O)CCl |
Computed by PubChem (NCBI)