CAS 1269053-56-6 is the registry number for N1-(2,4-Dimethylphenyl)-beta-alaninamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride (CAS 1269053-56-6) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride. InChIKey: NCPRNNMKIXEMQW-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride |
| InChIKey | NCPRNNMKIXEMQW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CCN)C.Cl |
Computed by PubChem (NCBI)