Products 1269053-84-0

CAS 1269053-84-0 is the registry number for N,N-Dimethyl-2-(4-piperidinyl)acetamide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

N,N-dimethyl-2-piperidin-4-ylacetamide;dihydrochloride (CAS 1269053-84-0) is a chemical compound with the molecular formula C9H20Cl2N2O and a molecular weight of 243.17 g/mol. IUPAC name: N,N-dimethyl-2-piperidin-4-ylacetamide;dihydrochloride. InChIKey: BJBJDEMBSULYLM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20Cl2N2O
Molecular weight243.17 g/mol
IUPAC nameN,N-dimethyl-2-piperidin-4-ylacetamide;dihydrochloride
InChIKeyBJBJDEMBSULYLM-UHFFFAOYSA-N
SMILESCN(C)C(=O)CC1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)