CAS 2306246-49-9 appears in our catalog under these names: (3S,4R)-3-Methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride, 95%, (3S,4R)-3-Methyl-2-oxa-8-azaspiro(4.5)decan-4-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(3S,4R)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine;dihydrochloride (CAS 2306246-49-9) is a chemical compound with the molecular formula C9H20Cl2N2O and a molecular weight of 243.17 g/mol. IUPAC name: (3S,4R)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine;dihydrochloride. InChIKey: DNEMBMRUCXTRGW-FOMWZSOGSA-N.
| Molecular formula | C9H20Cl2N2O |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | (3S,4R)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine;dihydrochloride |
| InChIKey | DNEMBMRUCXTRGW-FOMWZSOGSA-N |
| SMILES | C[C@H]1[C@@H](C2(CCNCC2)CO1)N.Cl.Cl |
Computed by PubChem (NCBI)