CAS 2227197-87-5 appears in our catalog under these names: (3R,4R)-3-Methyl-2-oxa-8-azaspiro[4.5]decan-4-amine dihydrochloride, 95%, (3R,4R)-3-Methyl-2-oxa-8-azaspiro(4.5)decan-4-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 5g, 1g.
(3R,4R)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine;dihydrochloride (CAS 2227197-87-5) is a chemical compound with the molecular formula C9H20Cl2N2O and a molecular weight of 243.17 g/mol. IUPAC name: (3R,4R)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine;dihydrochloride. InChIKey: DNEMBMRUCXTRGW-YUZCMTBUSA-N.
| Molecular formula | C9H20Cl2N2O |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | (3R,4R)-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine;dihydrochloride |
| InChIKey | DNEMBMRUCXTRGW-YUZCMTBUSA-N |
| SMILES | C[C@@H]1[C@@H](C2(CCNCC2)CO1)N.Cl.Cl |
Computed by PubChem (NCBI)