CAS 1269151-26-9 appears in our catalog under these names: 3-(4-(Trifluoromethyl)phenyl)cyclobutan-1-amine hydrochloride, 98%, 3-(4-(Trifluoromethyl)phenyl)cyclobutan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-[4-(trifluoromethyl)phenyl]cyclobutan-1-amine;hydrochloride (CAS 1269151-26-9) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]cyclobutan-1-amine;hydrochloride. InChIKey: GMNMPALGPKPXTG-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]cyclobutan-1-amine;hydrochloride |
| InChIKey | GMNMPALGPKPXTG-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)C2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)