CAS 1269394-19-5 appears in our catalog under these names: N1-(3,4-Dimethylphenyl)-beta-alaninamide hydrochloride, 95%, N~1~-(3,4-dimethylphenyl)-beta-alaninamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-amino-N-(3,4-dimethylphenyl)propanamide;hydrochloride (CAS 1269394-19-5) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 3-amino-N-(3,4-dimethylphenyl)propanamide;hydrochloride. InChIKey: DNILXIPDZDYGPP-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 3-amino-N-(3,4-dimethylphenyl)propanamide;hydrochloride |
| InChIKey | DNILXIPDZDYGPP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCN)C.Cl |
Computed by PubChem (NCBI)