CAS 1269437-75-3 appears in our catalog under these names: (R)–4–(1–Aminoethyl)aniline dihydrochloride, (R)-4-(1-Aminoethyl)aniline dihydrochloride, 95%, 95%, (R)-4-(1-Aminoethyl)aniline dihydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-[(1R)-1-aminoethyl]aniline;dihydrochloride (CAS 1269437-75-3) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]aniline;dihydrochloride. InChIKey: RBTZGSNSUNOPNF-QYCVXMPOSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]aniline;dihydrochloride |
| InChIKey | RBTZGSNSUNOPNF-QYCVXMPOSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)