CAS 1269469-78-4 appears in our catalog under these names: (S)–1–(3–Chloro–4–methylphenyl)ethanamine hydrochloride, (S)-1-(3-Chloro-4-methylphenyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(3-Chloro-4-methylphenyl)ethan-1-amine (hydrochloride), 99.16%, (S)-1-(3-Chloro-4-methylphenyl)ethan-1-amine (hydrochloride) (Standard). Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 1 g, 250 mg, 100 mg, 500 mg, 10 mg.
(1S)-1-(3-chloro-4-methylphenyl)ethanamine;hydrochloride (CAS 1269469-78-4) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: (1S)-1-(3-chloro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: HNXIRJOFFYIHSG-FJXQXJEOSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | (1S)-1-(3-chloro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | HNXIRJOFFYIHSG-FJXQXJEOSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@H](C)N)Cl.Cl |
Computed by PubChem (NCBI)