Products 1269476-63-2
CAS 1269476-63-2 is the registry number for 5-[(Methylamino)carbonyl]-2-thiophenesulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
5-(methylcarbamoyl)thiophene-2-sulfonyl chloride (CAS 1269476-63-2) is a chemical compound with the molecular formula C6H6ClNO3S2 and a molecular weight of 239.7 g/mol. IUPAC name: 5-(methylcarbamoyl)thiophene-2-sulfonyl chloride. InChIKey: UZZGGTHOVQQNBE-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S2 |
|---|---|
| Molecular weight | 239.7 g/mol |
| IUPAC name | 5-(methylcarbamoyl)thiophene-2-sulfonyl chloride |
| InChIKey | UZZGGTHOVQQNBE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=C(S1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)