CAS 1060817-61-9 appears in our catalog under these names: 5-(Methylcarbamoyl)thiophene-3-sulfonyl chloride, 95+%, 95+%, 5-[(methylamino)carbonyl]-3-thiophenesulfonyl chloride, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
5-(methylcarbamoyl)thiophene-3-sulfonyl chloride (CAS 1060817-61-9) is a chemical compound with the molecular formula C6H6ClNO3S2 and a molecular weight of 239.7 g/mol. IUPAC name: 5-(methylcarbamoyl)thiophene-3-sulfonyl chloride. InChIKey: IDELKMMSLSKSLV-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S2 |
|---|---|
| Molecular weight | 239.7 g/mol |
| IUPAC name | 5-(methylcarbamoyl)thiophene-3-sulfonyl chloride |
| InChIKey | IDELKMMSLSKSLV-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CS1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)