CAS 1479499-40-5 appears in our catalog under these names: 5-(Carbamoylmethyl)thiophene-2-sulfonyl chloride, 5-(Carbamoylmethyl)thiophene-2-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
5-(2-amino-2-oxoethyl)thiophene-2-sulfonyl chloride (CAS 1479499-40-5) is a chemical compound with the molecular formula C6H6ClNO3S2 and a molecular weight of 239.7 g/mol. IUPAC name: 5-(2-amino-2-oxoethyl)thiophene-2-sulfonyl chloride. InChIKey: XUKWKPLARLFETL-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO3S2 |
|---|---|
| Molecular weight | 239.7 g/mol |
| IUPAC name | 5-(2-amino-2-oxoethyl)thiophene-2-sulfonyl chloride |
| InChIKey | XUKWKPLARLFETL-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)Cl)CC(=O)N |
Computed by PubChem (NCBI)