CAS 1413393-01-7 is the registry number for (R)-6-Chloro-4-hydroxy-3,4-dihydro-2H-thieno[3,2-e][1,2]thiazine 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thieno[3,2-e]thiazin-4-ol (CAS 1413393-01-7) is a chemical compound with the molecular formula C6H6ClNO3S2 and a molecular weight of 239.7 g/mol. IUPAC name: (4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thieno[3,2-e]thiazin-4-ol. InChIKey: OFJGKGNJDCLNPM-BYPYZUCNSA-N.
| Molecular formula | C6H6ClNO3S2 |
|---|---|
| Molecular weight | 239.7 g/mol |
| IUPAC name | (4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thieno[3,2-e]thiazin-4-ol |
| InChIKey | OFJGKGNJDCLNPM-BYPYZUCNSA-N |
| SMILES | C1[C@@H](C2=C(SC(=C2)Cl)S(=O)(=O)N1)O |
Computed by PubChem (NCBI)