Products 1269604-49-0
CAS 1269604-49-0 is the registry number for 2',5'-Dimethoxy-[1,1':4',1''-terphenyl]-4,4''-diamine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4-aminophenyl)-2,5-dimethoxyphenyl]aniline (CAS 1269604-49-0) is a chemical compound with the molecular formula C20H20N2O2 and a molecular weight of 320.4 g/mol. IUPAC name: 4-[4-(4-aminophenyl)-2,5-dimethoxyphenyl]aniline. InChIKey: ZCGBJXFXWYUAAB-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-[4-(4-aminophenyl)-2,5-dimethoxyphenyl]aniline |
| InChIKey | ZCGBJXFXWYUAAB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2=CC=C(C=C2)N)OC)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)