Products 1269705-39-6
CAS 1269705-39-6 is the registry number for 4-Chloro-1-(3-fluorophenyl)-6-methyl-1H-pyrazolo(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-1-(3-fluorophenyl)-6-methylpyrazolo[5,4-d]pyrimidine (CAS 1269705-39-6) is a chemical compound with the molecular formula C12H8ClFN4 and a molecular weight of 262.67 g/mol. IUPAC name: 4-chloro-1-(3-fluorophenyl)-6-methylpyrazolo[5,4-d]pyrimidine. InChIKey: RXUCGANHFKLVBJ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFN4 |
|---|---|
| Molecular weight | 262.67 g/mol |
| IUPAC name | 4-chloro-1-(3-fluorophenyl)-6-methylpyrazolo[5,4-d]pyrimidine |
| InChIKey | RXUCGANHFKLVBJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C3=CC(=CC=C3)F)C(=N1)Cl |
Computed by PubChem (NCBI)