CAS 1296308-06-9 is the registry number for 6-Chloro-1-(2-fluorobenzyl)-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidine (CAS 1296308-06-9) is a chemical compound with the molecular formula C12H8ClFN4 and a molecular weight of 262.67 g/mol. IUPAC name: 6-chloro-1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidine. InChIKey: CWORVADYMSSAHM-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFN4 |
|---|---|
| Molecular weight | 262.67 g/mol |
| IUPAC name | 6-chloro-1-[(2-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidine |
| InChIKey | CWORVADYMSSAHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C3=NC(=NC=C3C=N2)Cl)F |
Computed by PubChem (NCBI)