CAS 1330624-42-4 appears in our catalog under these names: N-(3-Chloro-4-fluorophenyl)-1H-pyrazolo(4,3-b)pyridin-3-amine, 97%, N–(3–Chloro–4–fluorophenyl)–1H–pyrazolo(4,3–b)pyridin–3–amine, VU0418506. Offered by: AmBeed, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, Get quote.
N-(3-chloro-4-fluorophenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine (CAS 1330624-42-4) is a chemical compound with the molecular formula C12H8ClFN4 and a molecular weight of 262.67 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine. InChIKey: SBDWTBISUBYOMI-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFN4 |
|---|---|
| Molecular weight | 262.67 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-1H-pyrazolo[4,3-b]pyridin-3-amine |
| InChIKey | SBDWTBISUBYOMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NN2)NC3=CC(=C(C=C3)F)Cl)N=C1 |
Computed by PubChem (NCBI)