CAS 1269773-22-9 appears in our catalog under these names: (2S)-2-Amino-2-(2-fluorophenyl)ethan-1-ol hydrochloride, 95%, (S)-2-Amino-2-(2-fluorophenyl)ethanol hydrochloride, (S)-2-Amino-2-(2-fluorophenyl)ethanol hydrochloride, 95%, 95%, (2S)-2-AMINO-2-(2-FLUOROPHENYL)ETHAN-1-OL HCL, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 2,5g.
(2S)-2-amino-2-(2-fluorophenyl)ethanol;hydrochloride (CAS 1269773-22-9) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: (2S)-2-amino-2-(2-fluorophenyl)ethanol;hydrochloride. InChIKey: FHUUTFIWBXUNPK-DDWIOCJRSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-fluorophenyl)ethanol;hydrochloride |
| InChIKey | FHUUTFIWBXUNPK-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CO)N)F.Cl |
Computed by PubChem (NCBI)