CAS 2379311-62-1 appears in our catalog under these names: (S)–2–(1–Aminoethyl)–4–fluorophenol hydrochloride, 2-((1S)-1-Aminoethyl)-4-fluorophenol hydrochloride, 95%, (S)-2-(1-Aminoethyl)-4-fluorophenol hydrochloride 95%, (S)-2-(1-Aminoethyl)-4-fluorophenol hydrochloride, 95%, 95%, (S)-2-(1-Aminoethyl)-4-fluorophenol hydrochloride, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[(1S)-1-aminoethyl]-4-fluorophenol;hydrochloride (CAS 2379311-62-1) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: 2-[(1S)-1-aminoethyl]-4-fluorophenol;hydrochloride. InChIKey: WNTRCWFPNVNFGW-JEDNCBNOSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | 2-[(1S)-1-aminoethyl]-4-fluorophenol;hydrochloride |
| InChIKey | WNTRCWFPNVNFGW-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)F)O)N.Cl |
Computed by PubChem (NCBI)