CAS 1391447-14-5 appears in our catalog under these names: (R)-2-Amino-2-(3-fluorophenyl)ethanol hydrochloride, 95%, (R)–2–Amino–2–(3–fluorophenyl)ethanol hydrochloride, (R)-2-amino-2-(3-fluorophenyl)ethanol hydrochloride, (R)-2-Amino-2-(3-fluorophenyl)ethanol hydrochloride, 97%, 97%, (R)-2-Amino-2-(3-fluorophenyl)ethanol hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 2,5g, 5g, 10g.
(2R)-2-amino-2-(3-fluorophenyl)ethanol;hydrochloride (CAS 1391447-14-5) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: (2R)-2-amino-2-(3-fluorophenyl)ethanol;hydrochloride. InChIKey: VJMNCZRJJLXISS-QRPNPIFTSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-fluorophenyl)ethanol;hydrochloride |
| InChIKey | VJMNCZRJJLXISS-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)