Products 1269994-47-9
CAS 1269994-47-9 appears in our catalog under these names: (3S)-3-Amino-3-(5-methylfuran-2-yl)propanoic acid, (S)-3-Amino-3-(5-methylfuran-2-yl)propanoic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
(3S)-3-amino-3-(5-methylfuran-2-yl)propanoic acid (CAS 1269994-47-9) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: (3S)-3-amino-3-(5-methylfuran-2-yl)propanoic acid. InChIKey: QOWQYAAGGVGLJV-LURJTMIESA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (3S)-3-amino-3-(5-methylfuran-2-yl)propanoic acid |
| InChIKey | QOWQYAAGGVGLJV-LURJTMIESA-N |
| SMILES | CC1=CC=C(O1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)