Products 1270013-29-0
CAS 1270013-29-0 appears in our catalog under these names: 2-(trans-1,4-Dihydroxy-cyclohexyl)-5,7-dihydroxy-chromone, 2-(trans-1,4-Dihydroxy-cyclohexyl)-5,7-dihydroxy-chromone, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
2-(1,4-dihydroxycyclohexyl)-5,7-dihydroxychromen-4-one (CAS 1270013-29-0) is a chemical compound with the molecular formula C15H16O6 and a molecular weight of 292.28 g/mol. IUPAC name: 2-(1,4-dihydroxycyclohexyl)-5,7-dihydroxychromen-4-one. InChIKey: GDNDWFIQOXRVDM-UHFFFAOYSA-N.
| Molecular formula | C15H16O6 |
|---|---|
| Molecular weight | 292.28 g/mol |
| IUPAC name | 2-(1,4-dihydroxycyclohexyl)-5,7-dihydroxychromen-4-one |
| InChIKey | GDNDWFIQOXRVDM-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1O)(C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)