Products 1292798-98-1
CAS 1292798-98-1 appears in our catalog under these names: 4a–Demethoxysampsone B, 4a-Demethoxysampsone B. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4aS,10aR)-3,7,10a-trimethoxy-4,4a-dihydrodibenzo-p-dioxin-1-one (CAS 1292798-98-1) is a chemical compound with the molecular formula C15H16O6 and a molecular weight of 292.28 g/mol. IUPAC name: (4aS,10aR)-3,7,10a-trimethoxy-4,4a-dihydrodibenzo-p-dioxin-1-one. InChIKey: JHCCCGDYBWNZBF-GJZGRUSLSA-N.
| Molecular formula | C15H16O6 |
|---|---|
| Molecular weight | 292.28 g/mol |
| IUPAC name | (4aS,10aR)-3,7,10a-trimethoxy-4,4a-dihydrodibenzo-p-dioxin-1-one |
| InChIKey | JHCCCGDYBWNZBF-GJZGRUSLSA-N |
| SMILES | COC1=CC(=O)[C@]2([C@H](C1)OC3=C(O2)C=CC(=C3)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
4a-Demethoxysampsone B, orb1681002