CAS 1270036-47-9 is the registry number for 5-Bromo-2-methoxy-L-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.
(2S)-2-amino-3-(5-bromo-2-methoxyphenyl)propanoic acid (CAS 1270036-47-9) is a chemical compound with the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. IUPAC name: (2S)-2-amino-3-(5-bromo-2-methoxyphenyl)propanoic acid. InChIKey: REWQRRCVTMPNHM-QMMMGPOBSA-N.
| Molecular formula | C10H12BrNO3 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-bromo-2-methoxyphenyl)propanoic acid |
| InChIKey | REWQRRCVTMPNHM-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)