CAS 1270095-40-3 is the registry number for (1S)-2,2,2-Trifluoro-1-(1-methyl-1H-indol-3-yl)ethan-1-amine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-2,2,2-trifluoro-1-(1-methylindol-3-yl)ethanamine (CAS 1270095-40-3) is a chemical compound with the molecular formula C11H11F3N2 and a molecular weight of 228.21 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(1-methylindol-3-yl)ethanamine. InChIKey: WINLFBJAIXFLHV-JTQLQIEISA-N.
| Molecular formula | C11H11F3N2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(1-methylindol-3-yl)ethanamine |
| InChIKey | WINLFBJAIXFLHV-JTQLQIEISA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)