CAS 2305614-32-6 is the registry number for 5-Methyl-2-(4-(trifluoromethyl)phenyl)-4,5-dihydro-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1H-imidazole (CAS 2305614-32-6) is a chemical compound with the molecular formula C11H11F3N2 and a molecular weight of 228.21 g/mol. IUPAC name: 5-methyl-2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1H-imidazole. InChIKey: SCMOGFJZKPEGJA-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 5-methyl-2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1H-imidazole |
| InChIKey | SCMOGFJZKPEGJA-UHFFFAOYSA-N |
| SMILES | CC1CN=C(N1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)