Products 936493-21-9
CAS 936493-21-9 is the registry number for 3,3,3-Trifluoro-2-(1H-indol-3-yl)propan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3,3-trifluoro-2-(1H-indol-3-yl)propan-1-amine (CAS 936493-21-9) is a chemical compound with the molecular formula C11H11F3N2 and a molecular weight of 228.21 g/mol. IUPAC name: 3,3,3-trifluoro-2-(1H-indol-3-yl)propan-1-amine. InChIKey: ROBYHWXPMKUOAE-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-(1H-indol-3-yl)propan-1-amine |
| InChIKey | ROBYHWXPMKUOAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(CN)C(F)(F)F |
Computed by PubChem (NCBI)