Products 1270140-93-6

CAS 1270140-93-6 is the registry number for 1-tert-Butyl 4-methyl 4-formylpiperidine-1,4-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

1-O-tert-butyl 4-O-methyl 4-formylpiperidine-1,4-dicarboxylate (CAS 1270140-93-6) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-formylpiperidine-1,4-dicarboxylate. InChIKey: ORSYDLVMTMZUFS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21NO5
Molecular weight271.31 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl 4-formylpiperidine-1,4-dicarboxylate
InChIKeyORSYDLVMTMZUFS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)(C=O)C(=O)OC

Computed by PubChem (NCBI)