CAS 1270284-06-4 is the registry number for (R)-6-Chlorochroman-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-6-chloro-3,4-dihydro-2H-chromen-4-ol (CAS 1270284-06-4) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: (4R)-6-chloro-3,4-dihydro-2H-chromen-4-ol. InChIKey: DTXFWMLTXBVKIG-MRVPVSSYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (4R)-6-chloro-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | DTXFWMLTXBVKIG-MRVPVSSYSA-N |
| SMILES | C1COC2=C([C@@H]1O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)