CAS 1270291-39-8 appears in our catalog under these names: (4R)-6-Bromo-3,4-dihydro-2H-1-benzopyran-4-ol, 95%, (4R)-6-Bromo-3,4-dihydro-2H-1-benzopyran-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4R)-6-bromo-3,4-dihydro-2H-chromen-4-ol (CAS 1270291-39-8) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (4R)-6-bromo-3,4-dihydro-2H-chromen-4-ol. InChIKey: AUBCSGZQJXSWGV-MRVPVSSYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (4R)-6-bromo-3,4-dihydro-2H-chromen-4-ol |
| InChIKey | AUBCSGZQJXSWGV-MRVPVSSYSA-N |
| SMILES | C1COC2=C([C@@H]1O)C=C(C=C2)Br |
Computed by PubChem (NCBI)