CAS 1270368-71-2 is the registry number for 1-AMINO-6-BROMO-1,2,3,4-TETRAHYDRONAPHTHALENE-1-CARBOXYLIC ACID, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-amino-6-bromo-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CAS 1270368-71-2) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: 1-amino-6-bromo-3,4-dihydro-2H-naphthalene-1-carboxylic acid. InChIKey: UTXWNRSSRJHAAT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | 1-amino-6-bromo-3,4-dihydro-2H-naphthalene-1-carboxylic acid |
| InChIKey | UTXWNRSSRJHAAT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(C1)(C(=O)O)N |
Computed by PubChem (NCBI)