Products 1270398-88-3

CAS 1270398-88-3 is the registry number for 3-(1-Amino-2,2,2-trifluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(1-amino-2,2,2-trifluoroethyl)benzoic acid (CAS 1270398-88-3) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 3-(1-amino-2,2,2-trifluoroethyl)benzoic acid. InChIKey: GTGDSILNVYAYQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F3NO2
Molecular weight219.16 g/mol
IUPAC name3-(1-amino-2,2,2-trifluoroethyl)benzoic acid
InChIKeyGTGDSILNVYAYQQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C(C(F)(F)F)N

Computed by PubChem (NCBI)