CAS 1270398-88-3 is the registry number for 3-(1-Amino-2,2,2-trifluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-amino-2,2,2-trifluoroethyl)benzoic acid (CAS 1270398-88-3) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 3-(1-amino-2,2,2-trifluoroethyl)benzoic acid. InChIKey: GTGDSILNVYAYQQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 3-(1-amino-2,2,2-trifluoroethyl)benzoic acid |
| InChIKey | GTGDSILNVYAYQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(C(F)(F)F)N |
Computed by PubChem (NCBI)