Products 1270543-15-1

CAS 1270543-15-1 is the registry number for 4-(1-Aminoethyl)-3-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(1-aminoethyl)-3-methylbenzoic acid (CAS 1270543-15-1) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-(1-aminoethyl)-3-methylbenzoic acid. InChIKey: PYHLNBKUZFKWER-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC name4-(1-aminoethyl)-3-methylbenzoic acid
InChIKeyPYHLNBKUZFKWER-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(=O)O)C(C)N

Computed by PubChem (NCBI)