CAS 1270672-27-9 is the registry number for 2-(4-Fluoro-2-methylphenyl)-2-((2,2,2-trifluoroethyl)amino)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-fluoro-2-methylphenyl)-2-(2,2,2-trifluoroethylamino)acetic acid (CAS 1270672-27-9) is a chemical compound with the molecular formula C11H11F4NO2 and a molecular weight of 265.20 g/mol. IUPAC name: 2-(4-fluoro-2-methylphenyl)-2-(2,2,2-trifluoroethylamino)acetic acid. InChIKey: YNRJKQXMSNCWIN-UHFFFAOYSA-N.
| Molecular formula | C11H11F4NO2 |
|---|---|
| Molecular weight | 265.20 g/mol |
| IUPAC name | 2-(4-fluoro-2-methylphenyl)-2-(2,2,2-trifluoroethylamino)acetic acid |
| InChIKey | YNRJKQXMSNCWIN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C(C(=O)O)NCC(F)(F)F |
Computed by PubChem (NCBI)