CAS 1443220-92-5 appears in our catalog under these names: 3-(2-Fluorophenyl)azetidine 2,2,2-trifluoroacetate, 95%, 3-(2-Fluorophenyl)azetidine, trifluoroacetic acid, 3-(2-Fluorophenyl)azetidine 2,2,2-trifluoroacetate, 98%, 98%, 3-(2-Fluorophenyl)azetidine 2,2,2-trifluoroacetate, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg, 500mg.
3-(2-fluorophenyl)azetidine;2,2,2-trifluoroacetic acid (CAS 1443220-92-5) is a chemical compound with the molecular formula C11H11F4NO2 and a molecular weight of 265.20 g/mol. IUPAC name: 3-(2-fluorophenyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: GUTHFFSIZVJXGM-UHFFFAOYSA-N.
| Molecular formula | C11H11F4NO2 |
|---|---|
| Molecular weight | 265.20 g/mol |
| IUPAC name | 3-(2-fluorophenyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | GUTHFFSIZVJXGM-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=CC=C2F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)