Products 2351950-14-4

CAS 2351950-14-4 is the registry number for 2-Amino-3-(3-fluoro-4-trifluoromethyl-phenyl)-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-[3-fluoro-4-(trifluoromethyl)phenyl]propanoate (CAS 2351950-14-4) is a chemical compound with the molecular formula C11H11F4NO2 and a molecular weight of 265.20 g/mol. IUPAC name: methyl 2-amino-3-[3-fluoro-4-(trifluoromethyl)phenyl]propanoate. InChIKey: JADIMHYUMNTSJN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F4NO2
Molecular weight265.20 g/mol
IUPAC namemethyl 2-amino-3-[3-fluoro-4-(trifluoromethyl)phenyl]propanoate
InChIKeyJADIMHYUMNTSJN-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CC(=C(C=C1)C(F)(F)F)F)N

Computed by PubChem (NCBI)