CAS 127172-22-9 appears in our catalog under these names: (2E)-1-(3,4-Dimethoxyphenyl)-3-(dimethylamino)prop-2-en-1-one, 95%, 1-(3,4-Dimethoxy-phenyl)-3-dimethylamino-propenone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(E)-1-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 127172-22-9) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: (E)-1-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: SUPCYQIUOSDKPA-BQYQJAHWSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | (E)-1-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | SUPCYQIUOSDKPA-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)