Products 127183-56-6
CAS 127183-56-6 is the registry number for hex-3-ene-1,1,6,6-tetracarboxylic acid. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-hex-3-ene-1,1,6,6-tetracarboxylic acid (CAS 127183-56-6) is a chemical compound with the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. IUPAC name: (E)-hex-3-ene-1,1,6,6-tetracarboxylic acid. InChIKey: KJQQZMROZXQVEP-OWOJBTEDSA-N.
| Molecular formula | C10H12O8 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | (E)-hex-3-ene-1,1,6,6-tetracarboxylic acid |
| InChIKey | KJQQZMROZXQVEP-OWOJBTEDSA-N |
| SMILES | C(/C=C/CC(C(=O)O)C(=O)O)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)