Products 130-84-7
CAS 130-84-7 is the registry number for Dimethyl diacetoxyfumarate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl (Z)-2,3-diacetyloxybut-2-enedioate (CAS 130-84-7) is a chemical compound with the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. IUPAC name: dimethyl (Z)-2,3-diacetyloxybut-2-enedioate. InChIKey: NKGXGEHGPYWBDK-FPLPWBNLSA-N.
| Molecular formula | C10H12O8 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | dimethyl (Z)-2,3-diacetyloxybut-2-enedioate |
| InChIKey | NKGXGEHGPYWBDK-FPLPWBNLSA-N |
| SMILES | CC(=O)O/C(=C(/C(=O)OC)\OC(=O)C)/C(=O)OC |
Computed by PubChem (NCBI)