Products 1733-15-9

CAS 1733-15-9 is the registry number for Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tetramethyl ethene-1,1,2,2-tetracarboxylate (CAS 1733-15-9) is a chemical compound with the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. IUPAC name: tetramethyl ethene-1,1,2,2-tetracarboxylate. InChIKey: NPBUMSUYCUWTSF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O8
Molecular weight260.20 g/mol
IUPAC nametetramethyl ethene-1,1,2,2-tetracarboxylate
InChIKeyNPBUMSUYCUWTSF-UHFFFAOYSA-N
SMILESCOC(=O)C(=C(C(=O)OC)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)