CAS 1733-15-9 is the registry number for Ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tetramethyl ethene-1,1,2,2-tetracarboxylate (CAS 1733-15-9) is a chemical compound with the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. IUPAC name: tetramethyl ethene-1,1,2,2-tetracarboxylate. InChIKey: NPBUMSUYCUWTSF-UHFFFAOYSA-N.
| Molecular formula | C10H12O8 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | tetramethyl ethene-1,1,2,2-tetracarboxylate |
| InChIKey | NPBUMSUYCUWTSF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C(C(=O)OC)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)