CAS 127191-99-5 is the registry number for (Z)-3-Hydroxy-1,3-di(thiophen-2-yl)prop-2-en-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-hydroxy-1,3-dithiophen-2-ylprop-2-en-1-one (CAS 127191-99-5) is a chemical compound with the molecular formula C11H8O2S2 and a molecular weight of 236.3 g/mol. IUPAC name: (Z)-3-hydroxy-1,3-dithiophen-2-ylprop-2-en-1-one. InChIKey: LSZVMHRIKBGPFO-FPLPWBNLSA-N.
| Molecular formula | C11H8O2S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | (Z)-3-hydroxy-1,3-dithiophen-2-ylprop-2-en-1-one |
| InChIKey | LSZVMHRIKBGPFO-FPLPWBNLSA-N |
| SMILES | C1=CSC(=C1)/C(=C/C(=O)C2=CC=CS2)/O |
Computed by PubChem (NCBI)