CAS 156547-71-6 is the registry number for Spiro[cyclopenta[2,1-b:3,4-b']dithiophene-4,2'-[1,3]dioxolane], 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene] (CAS 156547-71-6) is a chemical compound with the molecular formula C11H8O2S2 and a molecular weight of 236.3 g/mol. IUPAC name: spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]. InChIKey: BCGOAEVQIBPZCC-UHFFFAOYSA-N.
| Molecular formula | C11H8O2S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | spiro[1,3-dioxolane-2,7'-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene] |
| InChIKey | BCGOAEVQIBPZCC-UHFFFAOYSA-N |
| SMILES | C1COC2(O1)C3=C(C4=C2C=CS4)SC=C3 |
Computed by PubChem (NCBI)