CAS 716-33-6 is the registry number for (Z)-2,3-Di(thiophen-2-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2,3-dithiophen-2-ylprop-2-enoic acid (CAS 716-33-6) is a chemical compound with the molecular formula C11H8O2S2 and a molecular weight of 236.3 g/mol. IUPAC name: (E)-2,3-dithiophen-2-ylprop-2-enoic acid. InChIKey: CWLNDKQJHPKCEM-CLFYSBASSA-N.
| Molecular formula | C11H8O2S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | (E)-2,3-dithiophen-2-ylprop-2-enoic acid |
| InChIKey | CWLNDKQJHPKCEM-CLFYSBASSA-N |
| SMILES | C1=CSC(=C1)/C=C(/C2=CC=CS2)\C(=O)O |
Computed by PubChem (NCBI)