CAS 1272721-75-1 is the registry number for 1H-Inden-1-amine, 5-bromo-6-fluoro-2,3-dihydro-, (1r)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1R)-5-bromo-6-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1272721-75-1) is a chemical compound with the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. IUPAC name: (1R)-5-bromo-6-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: PAIDTQZFFGGOMH-SECBINFHSA-N.
| Molecular formula | C9H9BrFN |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | (1R)-5-bromo-6-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | PAIDTQZFFGGOMH-SECBINFHSA-N |
| SMILES | C1CC2=CC(=C(C=C2[C@@H]1N)F)Br |
Computed by PubChem (NCBI)