CAS 2614187-07-2 is the registry number for 5-Bromo-6-fluoro-2,3-dihydro-1H-inden-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-fluoro-2,3-dihydro-1H-inden-4-amine (CAS 2614187-07-2) is a chemical compound with the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. IUPAC name: 5-bromo-6-fluoro-2,3-dihydro-1H-inden-4-amine. InChIKey: MUKVUGCWDWQYGF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFN |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2,3-dihydro-1H-inden-4-amine |
| InChIKey | MUKVUGCWDWQYGF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C(=C2C1)N)Br)F |
Computed by PubChem (NCBI)