CAS 1391497-70-3 is the registry number for (R)-4-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-amine (CAS 1391497-70-3) is a chemical compound with the molecular formula C9H9BrFN and a molecular weight of 230.08 g/mol. IUPAC name: (1R)-4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-amine. InChIKey: HZQGENLMMNOXDY-MRVPVSSYSA-N.
| Molecular formula | C9H9BrFN |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | (1R)-4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | HZQGENLMMNOXDY-MRVPVSSYSA-N |
| SMILES | C1CC2=C(C=CC(=C2[C@@H]1N)F)Br |
Computed by PubChem (NCBI)