CAS 1272730-24-1 is the registry number for (R)-5-Bromo-4-chloro-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-5-bromo-4-chloro-2,3-dihydro-1H-inden-1-amine (CAS 1272730-24-1) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: (1R)-5-bromo-4-chloro-2,3-dihydro-1H-inden-1-amine. InChIKey: CZHBTPMWPBFUOD-MRVPVSSYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | (1R)-5-bromo-4-chloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | CZHBTPMWPBFUOD-MRVPVSSYSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)